CAS No: 903130-23-4, Chemical Name: ethyl 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate
the physical and chemical property of 903130-23-4, ethyl 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate is provided by ChemNet.com
ChemNet > CAS > 903130-23-4 ethyl 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate
903130-23-4 ethyl 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate
상품명칭 |
ethyl 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate |
별명 |
ethyl 3-chloro-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate hydrochloride |
분자식 |
C9H12ClN3O2 |
분자량 |
229.6635 |
InChI |
InChI=1/C9H12ClN3O2/c1-2-15-9(14)7-8(10)13-4-3-11-5-6(13)12-7/h11H,2-5H2,1H3 |
cas번호 |
903130-23-4 |
분자 구조 |
|
밀도 |
1.5g/cm3 |
비등점 |
425.2°C at 760 mmHg |
굴절 지수 |
1.648 |
인화점 |
211°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|